C10H22N2O — CID 82740013
N,2-dimethyl-N-(oxolan-3-yl)butane-1,4-diamine (PubChem CID 82740013) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,2-dimethyl-N-(oxolan-3-yl)butane-1,4-diamine.
| Compound Name | N,2-dimethyl-N-(oxolan-3-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 82740013 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,2-dimethyl-N-(oxolan-3-yl)butane-1,4-diamine |
| SMILES | CC(CCN)CN(C)C1CCOC1 |
| InChI | InChI=1S/C10H22N2O/c1-9(3-5-11)7-12(2)10-4-6-13-8-10/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | JYFPCUPQCMFRCL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |