C9H20N2O — CID 63558740
N'-(oxolan-3-yl)-N'-propan-2-ylethane-1,2-diamine (PubChem CID 63558740) has the molecular formula C9H20N2O and a molecular weight of 172.27 g/mol. Its IUPAC name is N'-(oxolan-3-yl)-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N'-(oxolan-3-yl)-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 63558740 |
| Molecular Formula | C9H20N2O |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | N'-(oxolan-3-yl)-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(CCN)C1CCOC1 |
| InChI | InChI=1S/C9H20N2O/c1-8(2)11(5-4-10)9-3-6-12-7-9/h8-9H,3-7,10H2,1-2H3 |
| InChIKey | AKIPGGSQAAUYFM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |