About N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine
N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine (PubChem CID 82739452) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine |
| PubChem CID | 82739452 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine |
| SMILES | CC(CN)CCCN(C)C1CCOC1 |
| InChI | InChI=1S/C11H24N2O/c1-10(8-12)4-3-6-13(2)11-5-7-14-9-11/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | CAYSXVCBXWECCV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine?
The IUPAC name of N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine (CID 82739452) is N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine.
What is the SMILES notation for N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine?
The canonical SMILES for N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine is CC(CN)CCCN(C)C1CCOC1.
What is the InChIKey of N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine?
The InChIKey is CAYSXVCBXWECCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-10(8-12)4-3-6-13(2)11-5-7-14-9-11/h10-11H,3-9,12H2,1-2H3.
What are the key properties of N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine?
N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine has a molecular weight of 200.33 g/mol, XLogP of 1.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',2-dimethyl-N'-(oxolan-3-yl)pentane-1,5-diamine is sourced from PubChem (CID 82739452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).