About N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine
N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine (PubChem CID 63556391) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine.
Analyze N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine?
The IUPAC name of N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine (CID 63556391) is N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine.
What is the SMILES notation for N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine?
The canonical SMILES for N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine is CCN(CC(C)CN)C1CCOC1.
What is the InChIKey of N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine?
The InChIKey is IWNCMZRLLPVXAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-3-12(7-9(2)6-11)10-4-5-13-8-10/h9-10H,3-8,11H2,1-2H3.
What are the key properties of N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine?
N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine has a molecular weight of 186.30 g/mol, XLogP of 0.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-2-methyl-N'-(oxolan-3-yl)propane-1,3-diamine is sourced from PubChem (CID 63556391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).