C19H22N2O2 — CID 130317864
butyl N-(6,11-dihydro-5H-benzo[b][1]benzazepin-2-yl)carbamate (PubChem CID 130317864) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is butyl N-(6,11-dihydro-5H-benzo[b][1]benzazepin-2-yl)carbamate.
| Compound Name | butyl N-(6,11-dihydro-5H-benzo[b][1]benzazepin-2-yl)carbamate |
|---|---|
| PubChem CID | 130317864 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | butyl N-(6,11-dihydro-5H-benzo[b][1]benzazepin-2-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1ccc2c(c1)Nc1ccccc1CC2 |
| InChI | InChI=1S/C19H22N2O2/c1-2-3-12-23-19(22)20-16-11-10-15-9-8-14-6-4-5-7-17(14)21-18(15)13-16/h4-7,10-11,13,21H,2-3,8-9,12H2,1H3,(H,20,22) |
| InChIKey | OBIHPZZBRAKSLF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|