C19H19N3S3 — CID 130317964
4-hexyl-7-(5-thiophen-2-ylthiophen-2-yl)thiadiazolo[5,4-c]pyridine (PubChem CID 130317964) has the molecular formula C19H19N3S3 and a molecular weight of 385.58 g/mol. Its IUPAC name is 4-hexyl-7-(5-thiophen-2-ylthiophen-2-yl)thiadiazolo[5,4-c]pyridine.
| Compound Name | 4-hexyl-7-(5-thiophen-2-ylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 130317964 |
| Molecular Formula | C19H19N3S3 |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-hexyl-7-(5-thiophen-2-ylthiophen-2-yl)thiadiazolo[5,4-c]pyridine |
| SMILES | CCCCCCc1ncc(-c2ccc(-c3cccs3)s2)c2nnsc12 |
| InChI | InChI=1S/C19H19N3S3/c1-2-3-4-5-7-14-19-18(21-22-25-19)13(12-20-14)15-9-10-17(24-15)16-8-6-11-23-16/h6,8-12H,2-5,7H2,1H3 |
| InChIKey | VRPOKAMTXBGCOQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|