C10H7N3S2 — CID 90467784
6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-amine (PubChem CID 90467784) has the molecular formula C10H7N3S2 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-amine.
| Compound Name | 6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 90467784 |
| Molecular Formula | C10H7N3S2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | 6-thiophen-3-yl-[1,2]thiazolo[4,3-b]pyridin-3-amine |
| SMILES | Nc1snc2cc(-c3ccsc3)cnc12 |
| InChI | InChI=1S/C10H7N3S2/c11-10-9-8(13-15-10)3-7(4-12-9)6-1-2-14-5-6/h1-5H,11H2 |
| InChIKey | QQQURLMDMZMJRX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |