C17H21NO6S — CID 130318795
[(3,5-dimethoxynaphthalene-2-carbonyl)-methylamino] propane-1-sulfonate (PubChem CID 130318795) has the molecular formula C17H21NO6S and a molecular weight of 367.42 g/mol. Its IUPAC name is [(3,5-dimethoxynaphthalene-2-carbonyl)-methylamino] propane-1-sulfonate.
| Compound Name | [(3,5-dimethoxynaphthalene-2-carbonyl)-methylamino] propane-1-sulfonate |
|---|---|
| PubChem CID | 130318795 |
| Molecular Formula | C17H21NO6S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | [(3,5-dimethoxynaphthalene-2-carbonyl)-methylamino] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)ON(C)C(=O)c1cc2cccc(OC)c2cc1OC |
| InChI | InChI=1S/C17H21NO6S/c1-5-9-25(20,21)24-18(2)17(19)14-10-12-7-6-8-15(22-3)13(12)11-16(14)23-4/h6-8,10-11H,5,9H2,1-4H3 |
| InChIKey | QOODGRWTJCIFSS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|