C15H18O5S — CID 174485461
(6,7-dihydroxynaphthalen-1-yl) pentane-1-sulfonate (PubChem CID 174485461) has the molecular formula C15H18O5S and a molecular weight of 310.37 g/mol. Its IUPAC name is (6,7-dihydroxynaphthalen-1-yl) pentane-1-sulfonate.
| Compound Name | (6,7-dihydroxynaphthalen-1-yl) pentane-1-sulfonate |
|---|---|
| PubChem CID | 174485461 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (6,7-dihydroxynaphthalen-1-yl) pentane-1-sulfonate |
| SMILES | CCCCCS(=O)(=O)Oc1cccc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C15H18O5S/c1-2-3-4-8-21(18,19)20-15-7-5-6-11-9-13(16)14(17)10-12(11)15/h5-7,9-10,16-17H,2-4,8H2,1H3 |
| InChIKey | UWHHIIBUUBVEOG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|