C28H37N3O5S — CID 130320618
(E)-3-[4-[(1,1-dioxothian-4-yl)-(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pent-2-enoic acid (PubChem CID 130320618) has the molecular formula C28H37N3O5S and a molecular weight of 527.69 g/mol. Its IUPAC name is (E)-3-[4-[(1,1-dioxothian-4-yl)-(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pent-2-enoic acid.
| Compound Name | (E)-3-[4-[(1,1-dioxothian-4-yl)-(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 130320618 |
| Molecular Formula | C28H37N3O5S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (E)-3-[4-[(1,1-dioxothian-4-yl)-(2-methylpropyl)amino]-3-[(4-methylphenyl)carbamoylamino]phenyl]pent-2-enoic acid |
| SMILES | CC/C(=C\C(=O)O)c1ccc(N(CC(C)C)C2CCS(=O)(=O)CC2)c(NC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C28H37N3O5S/c1-5-21(17-27(32)33)22-8-11-26(31(18-19(2)3)24-12-14-37(35,36)15-13-24)25(16-22)30-28(34)29-23-9-6-20(4)7-10-23/h6-11,16-17,19,24H,5,12-15,18H2,1-4H3,(H,32,33)(H2,29,30,34)/b21-17+ |
| InChIKey | BGEUUWUGCXDPRL-HEHNFIMWSA-N |
| XLogP | 5.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|