C30H37N3O4 — CID 130409660
1-[5-[2-(dihydroxymethyl)phenyl]-2-[2-methylpropyl(oxan-4-yl)amino]phenyl]-3-(4-methylphenyl)urea (PubChem CID 130409660) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 1-[5-[2-(dihydroxymethyl)phenyl]-2-[2-methylpropyl(oxan-4-yl)amino]phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[5-[2-(dihydroxymethyl)phenyl]-2-[2-methylpropyl(oxan-4-yl)amino]phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 130409660 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 1-[5-[2-(dihydroxymethyl)phenyl]-2-[2-methylpropyl(oxan-4-yl)amino]phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cc(-c3ccccc3C(O)O)ccc2N(CC(C)C)C2CCOCC2)cc1 |
| InChI | InChI=1S/C30H37N3O4/c1-20(2)19-33(24-14-16-37-17-15-24)28-13-10-22(25-6-4-5-7-26(25)29(34)35)18-27(28)32-30(36)31-23-11-8-21(3)9-12-23/h4-13,18,20,24,29,34-35H,14-17,19H2,1-3H3,(H2,31,32,36) |
| InChIKey | VEPMZZFKQJXIKM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|