C32H35Cl2NO5 — CID 130321963
[4-(6-chlorohex-1-ynyl)-2-methoxyphenyl]methyl 4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carboxylate (PubChem CID 130321963) has the molecular formula C32H35Cl2NO5 and a molecular weight of 584.54 g/mol. Its IUPAC name is [4-(6-chlorohex-1-ynyl)-2-methoxyphenyl]methyl 4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carboxylate.
| Compound Name | [4-(6-chlorohex-1-ynyl)-2-methoxyphenyl]methyl 4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 130321963 |
| Molecular Formula | C32H35Cl2NO5 |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | [4-(6-chlorohex-1-ynyl)-2-methoxyphenyl]methyl 4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carboxylate |
| SMILES | COc1cc(C#CCCCCCl)ccc1COC(=O)C1=C(C)N(C[C@H]2CCCO2)C(=O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H35Cl2NO5/c1-22-31(32(37)40-21-25-11-10-23(18-29(25)38-2)8-5-3-4-6-16-33)28(24-12-14-26(34)15-13-24)19-30(36)35(22)20-27-9-7-17-39-27/h10-15,18,27-28H,3-4,6-7,9,16-17,19-21H2,1-2H3/t27-,28?/m1/s1 |
| InChIKey | BJKNFBIXOAUOMT-QXPUDEPPSA-N |
| XLogP | 6.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|