C29H33ClNO8S- — CID 140799430
4-[4-[[(4S)-4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carbonyl]oxymethyl]phenoxy]butane-1-sulfonate (PubChem CID 140799430) has the molecular formula C29H33ClNO8S- and a molecular weight of 591.10 g/mol. Its IUPAC name is 4-[4-[[(4S)-4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carbonyl]oxymethyl]phenoxy]butane-1-sulfonate.
| Compound Name | 4-[4-[[(4S)-4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carbonyl]oxymethyl]phenoxy]butane-1-sulfonate |
|---|---|
| PubChem CID | 140799430 |
| Molecular Formula | C29H33ClNO8S- |
| Molecular Weight | 591.10 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | 4-[4-[[(4S)-4-(4-chlorophenyl)-6-methyl-2-oxo-1-[[(2R)-oxolan-2-yl]methyl]-3,4-dihydropyridine-5-carbonyl]oxymethyl]phenoxy]butane-1-sulfonate |
| SMILES | CC1=C(C(=O)OCc2ccc(OCCCCS(=O)(=O)[O-])cc2)[C@H](c2ccc(Cl)cc2)CC(=O)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C29H34ClNO8S/c1-20-28(29(33)39-19-21-6-12-24(13-7-21)37-14-2-3-16-40(34,35)36)26(22-8-10-23(30)11-9-22)17-27(32)31(20)18-25-5-4-15-38-25/h6-13,25-26H,2-5,14-19H2,1H3,(H,34,35,36)/p-1/t25-,26+/m1/s1 |
| InChIKey | IOILNNTZKIPUFY-FTJBHMTQSA-M |
| XLogP | 4.56 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.10 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|