C12H14BrN3O3 — CID 130322770
ethyl 2-[3-[amino(hydroxy)methyl]-5-bromoindazol-1-yl]acetate (PubChem CID 130322770) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is ethyl 2-[3-[amino(hydroxy)methyl]-5-bromoindazol-1-yl]acetate.
| Compound Name | ethyl 2-[3-[amino(hydroxy)methyl]-5-bromoindazol-1-yl]acetate |
|---|---|
| PubChem CID | 130322770 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | ethyl 2-[3-[amino(hydroxy)methyl]-5-bromoindazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(N)O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H14BrN3O3/c1-2-19-10(17)6-16-9-4-3-7(13)5-8(9)11(15-16)12(14)18/h3-5,12,18H,2,6,14H2,1H3 |
| InChIKey | HBBOBGNTMMVOTO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|