C21H18O11 — CID 130323940
(2S,4S,5S,6S)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 130323940) has the molecular formula C21H18O11 and a molecular weight of 446.36 g/mol. Its IUPAC name is (2S,4S,5S,6S)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4S,5S,6S)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 130323940 |
| Molecular Formula | C21H18O11 |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (2S,4S,5S,6S)-6-[5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](O)[C@H](O)[C@H](Oc2cc3oc(-c4ccc(O)cc4)cc(=O)c3c(O)c2O)O1 |
| InChI | InChI=1S/C21H18O11/c22-9-3-1-8(2-4-9)12-5-10(23)16-13(30-12)7-14(18(26)19(16)27)31-21-17(25)11(24)6-15(32-21)20(28)29/h1-5,7,11,15,17,21-22,24-27H,6H2,(H,28,29)/t11-,15-,17-,21+/m0/s1 |
| InChIKey | QZMRVQQBPSYYSX-ZPIXSFHDSA-N |
| XLogP | 0.88 |
| TPSA | 187.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|