C21H20O8 — CID 143010037
5,6-dihydroxy-7-[6-(hydroxymethyl)oxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one (PubChem CID 143010037) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is 5,6-dihydroxy-7-[6-(hydroxymethyl)oxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one.
| Compound Name | 5,6-dihydroxy-7-[6-(hydroxymethyl)oxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 143010037 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 5,6-dihydroxy-7-[6-(hydroxymethyl)oxan-2-yl]oxy-2-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(OC3CCCC(CO)O3)c(O)c(O)c12 |
| InChI | InChI=1S/C21H20O8/c22-10-13-2-1-3-18(27-13)29-17-9-16-19(21(26)20(17)25)14(24)8-15(28-16)11-4-6-12(23)7-5-11/h4-9,13,18,22-23,25-26H,1-3,10H2 |
| InChIKey | VVJLZZVJCIZZHO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|