C11H9Cl2N5O — CID 130327596
[2,5-dichloro-4-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methanol (PubChem CID 130327596) has the molecular formula C11H9Cl2N5O and a molecular weight of 298.13 g/mol. Its IUPAC name is [2,5-dichloro-4-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methanol.
| Compound Name | [2,5-dichloro-4-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methanol |
|---|---|
| PubChem CID | 130327596 |
| Molecular Formula | C11H9Cl2N5O |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | [2,5-dichloro-4-(1-methylpyrazol-4-yl)pyrrolo[2,3-d]pyrimidin-7-yl]methanol |
| SMILES | Cn1cc(-c2nc(Cl)nc3c2c(Cl)cn3CO)cn1 |
| InChI | InChI=1S/C11H9Cl2N5O/c1-17-3-6(2-14-17)9-8-7(12)4-18(5-19)10(8)16-11(13)15-9/h2-4,19H,5H2,1H3 |
| InChIKey | DNVGSMCJIIKLBR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|