About 1-phenylethenyl 2-chloroacetate
1-phenylethenyl 2-chloroacetate (PubChem CID 13032777) has the molecular formula C10H9ClO2
and a molecular weight of 196.63 g/mol. Its IUPAC name is 1-phenylethenyl 2-chloroacetate.
Molecular Properties
| Compound Name | 1-phenylethenyl 2-chloroacetate |
| PubChem CID | 13032777 |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 1-phenylethenyl 2-chloroacetate |
| SMILES | C=C(OC(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C10H9ClO2/c1-8(13-10(12)7-11)9-5-3-2-4-6-9/h2-6H,1,7H2 |
| InChIKey | XIWAMKMZUPUMQU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylethenyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethenyl 2-chloroacetate?
The IUPAC name of 1-phenylethenyl 2-chloroacetate (CID 13032777) is 1-phenylethenyl 2-chloroacetate.
What is the SMILES notation for 1-phenylethenyl 2-chloroacetate?
The canonical SMILES for 1-phenylethenyl 2-chloroacetate is C=C(OC(=O)CCl)c1ccccc1.
What is the InChIKey of 1-phenylethenyl 2-chloroacetate?
The InChIKey is XIWAMKMZUPUMQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClO2/c1-8(13-10(12)7-11)9-5-3-2-4-6-9/h2-6H,1,7H2.
What are the key properties of 1-phenylethenyl 2-chloroacetate?
1-phenylethenyl 2-chloroacetate has a molecular weight of 196.63 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethenyl 2-chloroacetate is sourced from PubChem (CID 13032777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).