About bis(1-phenylethenyl) propanedioate
bis(1-phenylethenyl) propanedioate (PubChem CID 89421618) has the molecular formula C19H16O4
and a molecular weight of 308.33 g/mol. Its IUPAC name is bis(1-phenylethenyl) propanedioate.
Molecular Properties
| Compound Name | bis(1-phenylethenyl) propanedioate |
| PubChem CID | 89421618 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | bis(1-phenylethenyl) propanedioate |
| SMILES | C=C(OC(=O)CC(=O)OC(=C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16O4/c1-14(16-9-5-3-6-10-16)22-18(20)13-19(21)23-15(2)17-11-7-4-8-12-17/h3-12H,1-2,13H2 |
| InChIKey | VCMBIYAOSGQXBE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(1-phenylethenyl) propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-phenylethenyl) propanedioate?
The IUPAC name of bis(1-phenylethenyl) propanedioate (CID 89421618) is bis(1-phenylethenyl) propanedioate.
What is the SMILES notation for bis(1-phenylethenyl) propanedioate?
The canonical SMILES for bis(1-phenylethenyl) propanedioate is C=C(OC(=O)CC(=O)OC(=C)c1ccccc1)c1ccccc1.
What is the InChIKey of bis(1-phenylethenyl) propanedioate?
The InChIKey is VCMBIYAOSGQXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4/c1-14(16-9-5-3-6-10-16)22-18(20)13-19(21)23-15(2)17-11-7-4-8-12-17/h3-12H,1-2,13H2.
What are the key properties of bis(1-phenylethenyl) propanedioate?
bis(1-phenylethenyl) propanedioate has a molecular weight of 308.33 g/mol, XLogP of 3.80, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-phenylethenyl) propanedioate is sourced from PubChem (CID 89421618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).