C18H17ClN4O2 — CID 130329394
(E)-N-(4-chloro-3-hydroxyphenyl)-3-[4-(2-methyl-1,5-dihydropyrazol-4-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 130329394) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is (E)-N-(4-chloro-3-hydroxyphenyl)-3-[4-(2-methyl-1,5-dihydropyrazol-4-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-3-hydroxyphenyl)-3-[4-(2-methyl-1,5-dihydropyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 130329394 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (E)-N-(4-chloro-3-hydroxyphenyl)-3-[4-(2-methyl-1,5-dihydropyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | CN1C=C(c2ccncc2/C=C/C(=O)Nc2ccc(Cl)c(O)c2)CN1 |
| InChI | InChI=1S/C18H17ClN4O2/c1-23-11-13(10-21-23)15-6-7-20-9-12(15)2-5-18(25)22-14-3-4-16(19)17(24)8-14/h2-9,11,21,24H,10H2,1H3,(H,22,25)/b5-2+ |
| InChIKey | WWJUFWYTGYXNOA-GORDUTHDSA-N |
| XLogP | 2.88 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|