C21H23N5OS — CID 146206057
(E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]-N-[4-[(2-sulfanylethylamino)methyl]phenyl]prop-2-enamide (PubChem CID 146206057) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is (E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]-N-[4-[(2-sulfanylethylamino)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]-N-[4-[(2-sulfanylethylamino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146206057 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]-N-[4-[(2-sulfanylethylamino)methyl]phenyl]prop-2-enamide |
| SMILES | Cn1cc(-c2ccncc2/C=C/C(=O)Nc2ccc(CNCCS)cc2)cn1 |
| InChI | InChI=1S/C21H23N5OS/c1-26-15-18(14-24-26)20-8-9-22-13-17(20)4-7-21(27)25-19-5-2-16(3-6-19)12-23-10-11-28/h2-9,13-15,23,28H,10-12H2,1H3,(H,25,27)/b7-4+ |
| InChIKey | YVVVMDNKLIZNJW-QPJJXVBHSA-N |
| XLogP | 3.15 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|