C22H19N5O3S — CID 126568868
(E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide (PubChem CID 126568868) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 126568868 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (E)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enamide |
| SMILES | Cn1cc(-c2ccncc2/C=C/C(=O)Nc2ccc(CC3SC(=O)NC3=O)cc2)cn1 |
| InChI | InChI=1S/C22H19N5O3S/c1-27-13-16(12-24-27)18-8-9-23-11-15(18)4-7-20(28)25-17-5-2-14(3-6-17)10-19-21(29)26-22(30)31-19/h2-9,11-13,19H,10H2,1H3,(H,25,28)(H,26,29,30)/b7-4+ |
| InChIKey | OYJRFNLCHSBOOL-QPJJXVBHSA-N |
| XLogP | 3.03 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|