C17H15N5O2S — CID 126568637
5-[[(E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enoyl]amino]thiophene-2-carboxamide (PubChem CID 126568637) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 5-[[(E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enoyl]amino]thiophene-2-carboxamide.
| Compound Name | 5-[[(E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enoyl]amino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126568637 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-[[(E)-3-[4-(1-methylpyrazol-4-yl)-3-pyridinyl]prop-2-enoyl]amino]thiophene-2-carboxamide |
| SMILES | Cn1cc(-c2ccncc2/C=C/C(=O)Nc2ccc(C(N)=O)s2)cn1 |
| InChI | InChI=1S/C17H15N5O2S/c1-22-10-12(9-20-22)13-6-7-19-8-11(13)2-4-15(23)21-16-5-3-14(25-16)17(18)24/h2-10H,1H3,(H2,18,24)(H,21,23)/b4-2+ |
| InChIKey | LCLAUUZZGFWGIX-DUXPYHPUSA-N |
| XLogP | 2.29 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|