C25H29FN4O2 — CID 130329578
N-[2-[(5-fluoro-2-pyridinyl)oxymethyl]heptyl]-5-methyl-2-pyrimidin-2-ylbenzamide (PubChem CID 130329578) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is N-[2-[(5-fluoro-2-pyridinyl)oxymethyl]heptyl]-5-methyl-2-pyrimidin-2-ylbenzamide.
| Compound Name | N-[2-[(5-fluoro-2-pyridinyl)oxymethyl]heptyl]-5-methyl-2-pyrimidin-2-ylbenzamide |
|---|---|
| PubChem CID | 130329578 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N-[2-[(5-fluoro-2-pyridinyl)oxymethyl]heptyl]-5-methyl-2-pyrimidin-2-ylbenzamide |
| SMILES | CCCCCC(CNC(=O)c1cc(C)ccc1-c1ncccn1)COc1ccc(F)cn1 |
| InChI | InChI=1S/C25H29FN4O2/c1-3-4-5-7-19(17-32-23-11-9-20(26)16-29-23)15-30-25(31)22-14-18(2)8-10-21(22)24-27-12-6-13-28-24/h6,8-14,16,19H,3-5,7,15,17H2,1-2H3,(H,30,31) |
| InChIKey | LEZKJTUCVYAJNF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|