C20H25FN2O3 — CID 129095932
benzyl N-[4-[(5-fluoro-2-pyridinyl)oxymethyl]hexyl]carbamate (PubChem CID 129095932) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is benzyl N-[4-[(5-fluoro-2-pyridinyl)oxymethyl]hexyl]carbamate.
| Compound Name | benzyl N-[4-[(5-fluoro-2-pyridinyl)oxymethyl]hexyl]carbamate |
|---|---|
| PubChem CID | 129095932 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | benzyl N-[4-[(5-fluoro-2-pyridinyl)oxymethyl]hexyl]carbamate |
| SMILES | CCC(CCCNC(=O)OCc1ccccc1)COc1ccc(F)cn1 |
| InChI | InChI=1S/C20H25FN2O3/c1-2-16(14-25-19-11-10-18(21)13-23-19)9-6-12-22-20(24)26-15-17-7-4-3-5-8-17/h3-5,7-8,10-11,13,16H,2,6,9,12,14-15H2,1H3,(H,22,24) |
| InChIKey | IHLSJANFIZCZCP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|