C21H24FIN2O2 — CID 130329633
(2,5-dimethylphenyl)-[(3S)-3-[(5-fluoro-2-pyridinyl)methoxy]-2-(iodomethyl)piperidin-1-yl]methanone (PubChem CID 130329633) has the molecular formula C21H24FIN2O2 and a molecular weight of 482.34 g/mol. Its IUPAC name is (2,5-dimethylphenyl)-[(3S)-3-[(5-fluoro-2-pyridinyl)methoxy]-2-(iodomethyl)piperidin-1-yl]methanone.
| Compound Name | (2,5-dimethylphenyl)-[(3S)-3-[(5-fluoro-2-pyridinyl)methoxy]-2-(iodomethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 130329633 |
| Molecular Formula | C21H24FIN2O2 |
| Molecular Weight | 482.34 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (2,5-dimethylphenyl)-[(3S)-3-[(5-fluoro-2-pyridinyl)methoxy]-2-(iodomethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCC[C@H](OCc3ccc(F)cn3)C2CI)c1 |
| InChI | InChI=1S/C21H24FIN2O2/c1-14-5-6-15(2)18(10-14)21(26)25-9-3-4-20(19(25)11-23)27-13-17-8-7-16(22)12-24-17/h5-8,10,12,19-20H,3-4,9,11,13H2,1-2H3/t19?,20-/m0/s1 |
| InChIKey | SHCLDLBSHCJZFC-ANYOKISRSA-N |
| XLogP | 4.46 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|