C4H7ClN2O — CID 13033203
5-methyl-1,2-oxazol-4-amine;hydrochloride (PubChem CID 13033203) has the molecular formula C4H7ClN2O and a molecular weight of 134.57 g/mol. Its IUPAC name is 5-methyl-1,2-oxazol-4-amine;hydrochloride.
| Compound Name | 5-methyl-1,2-oxazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 13033203 |
| Molecular Formula | C4H7ClN2O |
| Molecular Weight | 134.57 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 5-methyl-1,2-oxazol-4-amine;hydrochloride |
| SMILES | Cc1oncc1N.Cl |
| InChI | InChI=1S/C4H6N2O.ClH/c1-3-4(5)2-6-7-3;/h2H,5H2,1H3;1H |
| InChIKey | DGZOHHHHZCANPV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.57 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |