C21H21F3N4O — CID 130335545
3-[3-[[[6-(trifluoromethyl)-1H-indazol-4-yl]amino]methyl]anilino]cyclohexan-1-one (PubChem CID 130335545) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is 3-[3-[[[6-(trifluoromethyl)-1H-indazol-4-yl]amino]methyl]anilino]cyclohexan-1-one.
| Compound Name | 3-[3-[[[6-(trifluoromethyl)-1H-indazol-4-yl]amino]methyl]anilino]cyclohexan-1-one |
|---|---|
| PubChem CID | 130335545 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[3-[[[6-(trifluoromethyl)-1H-indazol-4-yl]amino]methyl]anilino]cyclohexan-1-one |
| SMILES | O=C1CCCC(Nc2cccc(CNc3cc(C(F)(F)F)cc4[nH]ncc34)c2)C1 |
| InChI | InChI=1S/C21H21F3N4O/c22-21(23,24)14-8-19(18-12-26-28-20(18)9-14)25-11-13-3-1-4-15(7-13)27-16-5-2-6-17(29)10-16/h1,3-4,7-9,12,16,25,27H,2,5-6,10-11H2,(H,26,28) |
| InChIKey | FYSSRLXVUWZLHF-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |