C22H30O3 — CID 130337664
1-[3-[2-(2-cyclobutylphenyl)ethyl]cyclopentyl]-5-hydroxypentane-1,3-dione (PubChem CID 130337664) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[3-[2-(2-cyclobutylphenyl)ethyl]cyclopentyl]-5-hydroxypentane-1,3-dione.
| Compound Name | 1-[3-[2-(2-cyclobutylphenyl)ethyl]cyclopentyl]-5-hydroxypentane-1,3-dione |
|---|---|
| PubChem CID | 130337664 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[3-[2-(2-cyclobutylphenyl)ethyl]cyclopentyl]-5-hydroxypentane-1,3-dione |
| SMILES | O=C(CCO)CC(=O)C1CCC(CCc2ccccc2C2CCC2)C1 |
| InChI | InChI=1S/C22H30O3/c23-13-12-20(24)15-22(25)19-11-9-16(14-19)8-10-18-4-1-2-7-21(18)17-5-3-6-17/h1-2,4,7,16-17,19,23H,3,5-6,8-15H2 |
| InChIKey | PDSSBHPFNUAEEL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|