C27H37FO2 — CID 130328370
1-[1-[3-[2-(2-cyclopentyl-4-fluorophenyl)ethyl]cyclopentanecarbonyl]cyclobutyl]butan-1-one (PubChem CID 130328370) has the molecular formula C27H37FO2 and a molecular weight of 412.59 g/mol. Its IUPAC name is 1-[1-[3-[2-(2-cyclopentyl-4-fluorophenyl)ethyl]cyclopentanecarbonyl]cyclobutyl]butan-1-one.
| Compound Name | 1-[1-[3-[2-(2-cyclopentyl-4-fluorophenyl)ethyl]cyclopentanecarbonyl]cyclobutyl]butan-1-one |
|---|---|
| PubChem CID | 130328370 |
| Molecular Formula | C27H37FO2 |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-[1-[3-[2-(2-cyclopentyl-4-fluorophenyl)ethyl]cyclopentanecarbonyl]cyclobutyl]butan-1-one |
| SMILES | CCCC(=O)C1(C(=O)C2CCC(CCc3ccc(F)cc3C3CCCC3)C2)CCC1 |
| InChI | InChI=1S/C27H37FO2/c1-2-6-25(29)27(15-5-16-27)26(30)22-12-10-19(17-22)9-11-21-13-14-23(28)18-24(21)20-7-3-4-8-20/h13-14,18-20,22H,2-12,15-17H2,1H3 |
| InChIKey | RXGQNTXKDVIKAL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|