C17H22F2O2 — CID 116749944
2-(2,4-difluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone (PubChem CID 116749944) has the molecular formula C17H22F2O2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone.
| Compound Name | 2-(2,4-difluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 116749944 |
| Molecular Formula | C17H22F2O2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2ccc(F)cc2F)CCCC(C)C1 |
| InChI | InChI=1S/C17H22F2O2/c1-3-21-17(8-4-5-12(2)11-17)16(20)9-13-6-7-14(18)10-15(13)19/h6-7,10,12H,3-5,8-9,11H2,1-2H3 |
| InChIKey | QBUYDBOGSRKUIF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |