C17H23ClO2 — CID 116749891
2-(2-chlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone (PubChem CID 116749891) has the molecular formula C17H23ClO2 and a molecular weight of 294.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 116749891 |
| Molecular Formula | C17H23ClO2 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(2-chlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2ccccc2Cl)CCCC(C)C1 |
| InChI | InChI=1S/C17H23ClO2/c1-3-20-17(10-6-7-13(2)12-17)16(19)11-14-8-4-5-9-15(14)18/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3 |
| InChIKey | FDGSYPKERSYTGN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |