About 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone
2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone (PubChem CID 116749946) has the molecular formula C17H22Cl2O2
and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone.
Molecular Properties
| Compound Name | 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
| PubChem CID | 116749946 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone |
| SMILES | CCOC1(C(=O)Cc2c(Cl)cccc2Cl)CCCC(C)C1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-3-21-17(9-5-6-12(2)11-17)16(20)10-13-14(18)7-4-8-15(13)19/h4,7-8,12H,3,5-6,9-11H2,1-2H3 |
| InChIKey | BNXVBCWMJMZAGN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone?
The IUPAC name of 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone (CID 116749946) is 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone.
What is the SMILES notation for 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone?
The canonical SMILES for 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone is CCOC1(C(=O)Cc2c(Cl)cccc2Cl)CCCC(C)C1.
What is the InChIKey of 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone?
The InChIKey is BNXVBCWMJMZAGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22Cl2O2/c1-3-21-17(9-5-6-12(2)11-17)16(20)10-13-14(18)7-4-8-15(13)19/h4,7-8,12H,3,5-6,9-11H2,1-2H3.
What are the key properties of 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone?
2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone has a molecular weight of 329.27 g/mol, XLogP of 5.09, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dichlorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanone is sourced from PubChem (CID 116749946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).