C17H23FO3 — CID 116749993
(1-ethoxy-3-methylcyclohexyl)-(3-fluoro-4-methoxyphenyl)methanone (PubChem CID 116749993) has the molecular formula C17H23FO3 and a molecular weight of 294.37 g/mol. Its IUPAC name is (1-ethoxy-3-methylcyclohexyl)-(3-fluoro-4-methoxyphenyl)methanone.
| Compound Name | (1-ethoxy-3-methylcyclohexyl)-(3-fluoro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 116749993 |
| Molecular Formula | C17H23FO3 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (1-ethoxy-3-methylcyclohexyl)-(3-fluoro-4-methoxyphenyl)methanone |
| SMILES | CCOC1(C(=O)c2ccc(OC)c(F)c2)CCCC(C)C1 |
| InChI | InChI=1S/C17H23FO3/c1-4-21-17(9-5-6-12(2)11-17)16(19)13-7-8-15(20-3)14(18)10-13/h7-8,10,12H,4-6,9,11H2,1-3H3 |
| InChIKey | WWOQAUATVBWGKC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |