C21H24F3NO5 — CID 130337770
ethyl 2-[(3-methoxy-3-oxopropanoyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclohexene-1-carboxylate (PubChem CID 130337770) has the molecular formula C21H24F3NO5 and a molecular weight of 427.42 g/mol. Its IUPAC name is ethyl 2-[(3-methoxy-3-oxopropanoyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclohexene-1-carboxylate.
| Compound Name | ethyl 2-[(3-methoxy-3-oxopropanoyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 130337770 |
| Molecular Formula | C21H24F3NO5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | ethyl 2-[(3-methoxy-3-oxopropanoyl)-[[4-(trifluoromethyl)phenyl]methyl]amino]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(N(Cc2ccc(C(F)(F)F)cc2)C(=O)CC(=O)OC)CCCC1 |
| InChI | InChI=1S/C21H24F3NO5/c1-3-30-20(28)16-6-4-5-7-17(16)25(18(26)12-19(27)29-2)13-14-8-10-15(11-9-14)21(22,23)24/h8-11H,3-7,12-13H2,1-2H3 |
| InChIKey | ILNXNHCYRFDZMZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|