C15H18IN3O2 — CID 130337842
(2-iodo-1H-indol-4-yl) N-(1-methylpiperidin-4-yl)carbamate (PubChem CID 130337842) has the molecular formula C15H18IN3O2 and a molecular weight of 399.23 g/mol. Its IUPAC name is (2-iodo-1H-indol-4-yl) N-(1-methylpiperidin-4-yl)carbamate.
| Compound Name | (2-iodo-1H-indol-4-yl) N-(1-methylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 130337842 |
| Molecular Formula | C15H18IN3O2 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | (2-iodo-1H-indol-4-yl) N-(1-methylpiperidin-4-yl)carbamate |
| SMILES | CN1CCC(NC(=O)Oc2cccc3[nH]c(I)cc23)CC1 |
| InChI | InChI=1S/C15H18IN3O2/c1-19-7-5-10(6-8-19)17-15(20)21-13-4-2-3-12-11(13)9-14(16)18-12/h2-4,9-10,18H,5-8H2,1H3,(H,17,20) |
| InChIKey | MXDHFINCTSMJMX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|