C29H31FN4O2 — CID 163300252
2-(9H-carbazol-2-yl)-N-[(4-fluorophenyl)methyl]-N'-(1-methylpiperidin-4-yl)butanediamide (PubChem CID 163300252) has the molecular formula C29H31FN4O2 and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-(9H-carbazol-2-yl)-N-[(4-fluorophenyl)methyl]-N'-(1-methylpiperidin-4-yl)butanediamide.
| Compound Name | 2-(9H-carbazol-2-yl)-N-[(4-fluorophenyl)methyl]-N'-(1-methylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 163300252 |
| Molecular Formula | C29H31FN4O2 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-(9H-carbazol-2-yl)-N-[(4-fluorophenyl)methyl]-N'-(1-methylpiperidin-4-yl)butanediamide |
| SMILES | CN1CCC(NC(=O)CC(C(=O)NCc2ccc(F)cc2)c2ccc3c(c2)[nH]c2ccccc23)CC1 |
| InChI | InChI=1S/C29H31FN4O2/c1-34-14-12-22(13-15-34)32-28(35)17-25(29(36)31-18-19-6-9-21(30)10-7-19)20-8-11-24-23-4-2-3-5-26(23)33-27(24)16-20/h2-11,16,22,25,33H,12-15,17-18H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | OHANBHDXNWGVKP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |