C21H18FN3O — CID 163300286
N-[(4-aminophenyl)methyl]-2-(7-fluoro-9H-carbazol-2-yl)acetamide (PubChem CID 163300286) has the molecular formula C21H18FN3O and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-2-(7-fluoro-9H-carbazol-2-yl)acetamide.
| Compound Name | N-[(4-aminophenyl)methyl]-2-(7-fluoro-9H-carbazol-2-yl)acetamide |
|---|---|
| PubChem CID | 163300286 |
| Molecular Formula | C21H18FN3O |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-2-(7-fluoro-9H-carbazol-2-yl)acetamide |
| SMILES | Nc1ccc(CNC(=O)Cc2ccc3c(c2)[nH]c2cc(F)ccc23)cc1 |
| InChI | InChI=1S/C21H18FN3O/c22-15-4-8-18-17-7-3-14(9-19(17)25-20(18)11-15)10-21(26)24-12-13-1-5-16(23)6-2-13/h1-9,11,25H,10,12,23H2,(H,24,26) |
| InChIKey | VWOVBVQKOBSIMM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|