C21H15FN2O3 — CID 163300250
4-[[2-(7-fluoro-9H-carbazol-2-yl)acetyl]amino]benzoic acid (PubChem CID 163300250) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-[[2-(7-fluoro-9H-carbazol-2-yl)acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(7-fluoro-9H-carbazol-2-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 163300250 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-[[2-(7-fluoro-9H-carbazol-2-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(Cc1ccc2c(c1)[nH]c1cc(F)ccc12)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H15FN2O3/c22-14-4-8-17-16-7-1-12(9-18(16)24-19(17)11-14)10-20(25)23-15-5-2-13(3-6-15)21(26)27/h1-9,11,24H,10H2,(H,23,25)(H,26,27) |
| InChIKey | REHQHYKRIWMECU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |