C28H33F3N6O3S — CID 130337995
4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-N'-methylpiperidine-1-carboximidamide (PubChem CID 130337995) has the molecular formula C28H33F3N6O3S and a molecular weight of 590.67 g/mol. Its IUPAC name is 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-N'-methylpiperidine-1-carboximidamide.
| Compound Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-N'-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 130337995 |
| Molecular Formula | C28H33F3N6O3S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 4-[[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S(C)(=O)=O)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C28H33F3N6O3S/c1-33-27(32)36-14-11-19(12-15-36)35-23-7-4-8-25-22(23)16-20(37(25)18-28(29,30)31)6-5-13-34-24-10-9-21(41(3,38)39)17-26(24)40-2/h4,7-10,16-17,19,34-35H,11-15,18H2,1-3H3,(H2,32,33) |
| InChIKey | LLYJDZOTVKQVLA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|