C26H28F3N5O2 — CID 130338379
3-methoxy-4-[3-[4-(piperidin-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide (PubChem CID 130338379) has the molecular formula C26H28F3N5O2 and a molecular weight of 499.54 g/mol. Its IUPAC name is 3-methoxy-4-[3-[4-(piperidin-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide.
| Compound Name | 3-methoxy-4-[3-[4-(piperidin-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
|---|---|
| PubChem CID | 130338379 |
| Molecular Formula | C26H28F3N5O2 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 3-methoxy-4-[3-[4-(piperidin-4-ylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]benzamide |
| SMILES | COc1cc(C(N)=O)ccc1NCC#Cc1cc2c(NC3CCNCC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C26H28F3N5O2/c1-36-24-14-17(25(30)35)7-8-22(24)32-11-3-4-19-15-20-21(33-18-9-12-31-13-10-18)5-2-6-23(20)34(19)16-26(27,28)29/h2,5-8,14-15,18,31-33H,9-13,16H2,1H3,(H2,30,35) |
| InChIKey | IEPNGSXHWCYCFI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|