C12H13N3OS — CID 13034031
2-butyl-[1,2,4]thiadiazolo[4,5-a]benzimidazol-1-one (PubChem CID 13034031) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-butyl-[1,2,4]thiadiazolo[4,5-a]benzimidazol-1-one.
| Compound Name | 2-butyl-[1,2,4]thiadiazolo[4,5-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 13034031 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2-butyl-[1,2,4]thiadiazolo[4,5-a]benzimidazol-1-one |
| SMILES | CCCCn1sc2nc3ccccc3n2c1=O |
| InChI | InChI=1S/C12H13N3OS/c1-2-3-8-14-12(16)15-10-7-5-4-6-9(10)13-11(15)17-14/h4-7H,2-3,8H2,1H3 |
| InChIKey | MVIDVCMJRNZUCO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|