C18H17ClFN3 — CID 130340808
(Z)-4-(5-chloro-2-methyl-3-pyridin-4-ylindol-1-yl)-3-fluorobut-2-en-1-amine (PubChem CID 130340808) has the molecular formula C18H17ClFN3 and a molecular weight of 329.81 g/mol. Its IUPAC name is (Z)-4-(5-chloro-2-methyl-3-pyridin-4-ylindol-1-yl)-3-fluorobut-2-en-1-amine.
| Compound Name | (Z)-4-(5-chloro-2-methyl-3-pyridin-4-ylindol-1-yl)-3-fluorobut-2-en-1-amine |
|---|---|
| PubChem CID | 130340808 |
| Molecular Formula | C18H17ClFN3 |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (Z)-4-(5-chloro-2-methyl-3-pyridin-4-ylindol-1-yl)-3-fluorobut-2-en-1-amine |
| SMILES | Cc1c(-c2ccncc2)c2cc(Cl)ccc2n1C/C(F)=C/CN |
| InChI | InChI=1S/C18H17ClFN3/c1-12-18(13-5-8-22-9-6-13)16-10-14(19)2-3-17(16)23(12)11-15(20)4-7-21/h2-6,8-10H,7,11,21H2,1H3/b15-4- |
| InChIKey | RTJBWWUDJSWTAR-TVPGTPATSA-N |
| XLogP | 4.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |