C19H18F2N2 — CID 155166141
3-fluoro-4-[3-(4-fluorophenyl)-2-methylindol-1-yl]but-2-en-1-amine (PubChem CID 155166141) has the molecular formula C19H18F2N2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-fluoro-4-[3-(4-fluorophenyl)-2-methylindol-1-yl]but-2-en-1-amine.
| Compound Name | 3-fluoro-4-[3-(4-fluorophenyl)-2-methylindol-1-yl]but-2-en-1-amine |
|---|---|
| PubChem CID | 155166141 |
| Molecular Formula | C19H18F2N2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-fluoro-4-[3-(4-fluorophenyl)-2-methylindol-1-yl]but-2-en-1-amine |
| SMILES | Cc1c(-c2ccc(F)cc2)c2ccccc2n1CC(F)=CCN |
| InChI | InChI=1S/C19H18F2N2/c1-13-19(14-6-8-15(20)9-7-14)17-4-2-3-5-18(17)23(13)12-16(21)10-11-22/h2-10H,11-12,22H2,1H3 |
| InChIKey | OXSKHEAEVOOIBZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |