C15H15F2N3 — CID 130341415
(E)-2-fluoro-N'-[1-(7-fluoro-5-methyl-1H-indol-3-yl)ethenyl]but-2-enimidamide (PubChem CID 130341415) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is (E)-2-fluoro-N'-[1-(7-fluoro-5-methyl-1H-indol-3-yl)ethenyl]but-2-enimidamide.
| Compound Name | (E)-2-fluoro-N'-[1-(7-fluoro-5-methyl-1H-indol-3-yl)ethenyl]but-2-enimidamide |
|---|---|
| PubChem CID | 130341415 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (E)-2-fluoro-N'-[1-(7-fluoro-5-methyl-1H-indol-3-yl)ethenyl]but-2-enimidamide |
| SMILES | C=C(/N=C(N)/C(F)=C\C)c1c[nH]c2c(F)cc(C)cc12 |
| InChI | InChI=1S/C15H15F2N3/c1-4-12(16)15(18)20-9(3)11-7-19-14-10(11)5-8(2)6-13(14)17/h4-7,19H,3H2,1-2H3,(H2,18,20)/b12-4+ |
| InChIKey | ALIBWUISVBDJOV-UUILKARUSA-N |
| XLogP | 3.82 |
| TPSA | 54.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|