C26H23F2NO3 — CID 126706430
1-(7-fluoro-5-methyl-1H-indol-3-yl)-2-[4-fluoro-2-(2-phenylmethoxyethoxy)phenyl]ethanone (PubChem CID 126706430) has the molecular formula C26H23F2NO3 and a molecular weight of 435.47 g/mol. Its IUPAC name is 1-(7-fluoro-5-methyl-1H-indol-3-yl)-2-[4-fluoro-2-(2-phenylmethoxyethoxy)phenyl]ethanone.
| Compound Name | 1-(7-fluoro-5-methyl-1H-indol-3-yl)-2-[4-fluoro-2-(2-phenylmethoxyethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 126706430 |
| Molecular Formula | C26H23F2NO3 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 1-(7-fluoro-5-methyl-1H-indol-3-yl)-2-[4-fluoro-2-(2-phenylmethoxyethoxy)phenyl]ethanone |
| SMILES | Cc1cc(F)c2[nH]cc(C(=O)Cc3ccc(F)cc3OCCOCc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H23F2NO3/c1-17-11-21-22(15-29-26(21)23(28)12-17)24(30)13-19-7-8-20(27)14-25(19)32-10-9-31-16-18-5-3-2-4-6-18/h2-8,11-12,14-15,29H,9-10,13,16H2,1H3 |
| InChIKey | AIKAHBRFXODQBP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|