C25H23ClFNO3 — CID 126714735
2-[4-chloro-2-(2-phenylmethoxyethoxy)phenyl]-1-(6-fluoro-1H-indol-3-yl)ethanol (PubChem CID 126714735) has the molecular formula C25H23ClFNO3 and a molecular weight of 439.91 g/mol. Its IUPAC name is 2-[4-chloro-2-(2-phenylmethoxyethoxy)phenyl]-1-(6-fluoro-1H-indol-3-yl)ethanol.
| Compound Name | 2-[4-chloro-2-(2-phenylmethoxyethoxy)phenyl]-1-(6-fluoro-1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 126714735 |
| Molecular Formula | C25H23ClFNO3 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[4-chloro-2-(2-phenylmethoxyethoxy)phenyl]-1-(6-fluoro-1H-indol-3-yl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1OCCOCc1ccccc1)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C25H23ClFNO3/c26-19-7-6-18(12-24(29)22-15-28-23-14-20(27)8-9-21(22)23)25(13-19)31-11-10-30-16-17-4-2-1-3-5-17/h1-9,13-15,24,28-29H,10-12,16H2 |
| InChIKey | OJRTWKKWJNDMSS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|