C24H28FNO4 — CID 126706402
2-[2-(2-butoxyethoxy)-4-fluorophenyl]-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone (PubChem CID 126706402) has the molecular formula C24H28FNO4 and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)-4-fluorophenyl]-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-[2-(2-butoxyethoxy)-4-fluorophenyl]-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 126706402 |
| Molecular Formula | C24H28FNO4 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)-4-fluorophenyl]-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone |
| SMILES | CCCCOCCOc1cc(F)ccc1CC(=O)c1c[nH]c2cc(OC)c(C)cc12 |
| InChI | InChI=1S/C24H28FNO4/c1-4-5-8-29-9-10-30-24-13-18(25)7-6-17(24)12-22(27)20-15-26-21-14-23(28-3)16(2)11-19(20)21/h6-7,11,13-15,26H,4-5,8-10,12H2,1-3H3 |
| InChIKey | RTNGJWWRBFQENK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|