C19H17BrFNO3 — CID 121254987
2-bromo-2-(4-fluoro-2-methoxyphenyl)-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone (PubChem CID 121254987) has the molecular formula C19H17BrFNO3 and a molecular weight of 406.25 g/mol. Its IUPAC name is 2-bromo-2-(4-fluoro-2-methoxyphenyl)-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone.
| Compound Name | 2-bromo-2-(4-fluoro-2-methoxyphenyl)-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 121254987 |
| Molecular Formula | C19H17BrFNO3 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 2-bromo-2-(4-fluoro-2-methoxyphenyl)-1-(6-methoxy-5-methyl-1H-indol-3-yl)ethanone |
| SMILES | COc1cc2[nH]cc(C(=O)C(Br)c3ccc(F)cc3OC)c2cc1C |
| InChI | InChI=1S/C19H17BrFNO3/c1-10-6-13-14(9-22-15(13)8-16(10)24-2)19(23)18(20)12-5-4-11(21)7-17(12)25-3/h4-9,18,22H,1-3H3 |
| InChIKey | KDYNHHMALYJBBT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|