C20H19BrFNO3 — CID 131964288
2-bromo-1-(6-ethoxy-5-methyl-1H-indol-3-yl)-2-(4-fluoro-2-methoxyphenyl)ethanone (PubChem CID 131964288) has the molecular formula C20H19BrFNO3 and a molecular weight of 420.28 g/mol. Its IUPAC name is 2-bromo-1-(6-ethoxy-5-methyl-1H-indol-3-yl)-2-(4-fluoro-2-methoxyphenyl)ethanone.
| Compound Name | 2-bromo-1-(6-ethoxy-5-methyl-1H-indol-3-yl)-2-(4-fluoro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 131964288 |
| Molecular Formula | C20H19BrFNO3 |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-bromo-1-(6-ethoxy-5-methyl-1H-indol-3-yl)-2-(4-fluoro-2-methoxyphenyl)ethanone |
| SMILES | CCOc1cc2[nH]cc(C(=O)C(Br)c3ccc(F)cc3OC)c2cc1C |
| InChI | InChI=1S/C20H19BrFNO3/c1-4-26-17-9-16-14(7-11(17)2)15(10-23-16)20(24)19(21)13-6-5-12(22)8-18(13)25-3/h5-10,19,23H,4H2,1-3H3 |
| InChIKey | QISXICVLXOLQIL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|